C29H21ClN2O5 — CID 124894798
[(10R,11R,15S,16R)-16-benzoyl-13-(4-chlorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-3-yl] acetate (PubChem CID 124894798) has the molecular formula C29H21ClN2O5 and a molecular weight of 512.95 g/mol. Its IUPAC name is [(10R,11R,15S,16R)-16-benzoyl-13-(4-chlorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-3-yl] acetate.
| Compound Name | [(10R,11R,15S,16R)-16-benzoyl-13-(4-chlorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-3-yl] acetate |
|---|---|
| PubChem CID | 124894798 |
| Molecular Formula | C29H21ClN2O5 |
| Molecular Weight | 512.95 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | [(10R,11R,15S,16R)-16-benzoyl-13-(4-chlorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-3-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1N1[C@H](C=C2)[C@@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)[C@@H]2[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H21ClN2O5/c1-16(33)37-22-9-5-8-17-10-15-21-23-24(29(36)31(28(23)35)20-13-11-19(30)12-14-20)26(32(21)25(17)22)27(34)18-6-3-2-4-7-18/h2-15,21,23-24,26H,1H3/t21-,23+,24+,26-/m1/s1 |
| InChIKey | TXWBUKOFJYRADF-BPEMXEAKSA-N |
| XLogP | 4.54 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.95 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|