C31H27N3O6 — CID 6580619
(10R,11R,15R,16S)-13-(4-butoxyphenyl)-16-(3-nitrobenzoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 6580619) has the molecular formula C31H27N3O6 and a molecular weight of 537.57 g/mol. Its IUPAC name is (10R,11R,15R,16S)-13-(4-butoxyphenyl)-16-(3-nitrobenzoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11R,15R,16S)-13-(4-butoxyphenyl)-16-(3-nitrobenzoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 6580619 |
| Molecular Formula | C31H27N3O6 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | (10R,11R,15R,16S)-13-(4-butoxyphenyl)-16-(3-nitrobenzoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | CCCCOc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H](C(=O)c2cccc([N+](=O)[O-])c2)N2c4ccccc4C=C[C@H]32)cc1 |
| InChI | InChI=1S/C31H27N3O6/c1-2-3-17-40-23-14-12-21(13-15-23)32-30(36)26-25-16-11-19-7-4-5-10-24(19)33(25)28(27(26)31(32)37)29(35)20-8-6-9-22(18-20)34(38)39/h4-16,18,25-28H,2-3,17H2,1H3/t25-,26+,27-,28+/m1/s1 |
| InChIKey | CMICDHUVEMGCEC-GCFVYEKYSA-N |
| XLogP | 5.05 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|