C21H15N3O5 — CID 124779139
(10R,11R,15R,16S)-16-(3-nitrobenzoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 124779139) has the molecular formula C21H15N3O5 and a molecular weight of 389.37 g/mol. Its IUPAC name is (10R,11R,15R,16S)-16-(3-nitrobenzoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11R,15R,16S)-16-(3-nitrobenzoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 124779139 |
| Molecular Formula | C21H15N3O5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (10R,11R,15R,16S)-16-(3-nitrobenzoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | O=C1NC(=O)[C@@H]2[C@@H]1[C@H]1C=Cc3ccccc3N1[C@@H]2C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H15N3O5/c25-19(12-5-3-6-13(10-12)24(28)29)18-17-16(20(26)22-21(17)27)15-9-8-11-4-1-2-7-14(11)23(15)18/h1-10,15-18H,(H,22,26,27)/t15-,16+,17-,18+/m1/s1 |
| InChIKey | CVZXNSIMGSRIKM-XDNAFOTISA-N |
| XLogP | 1.95 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|