C16H12N4O5 — CID 51451800
(1R,2S,6R,7R)-7-(3-nitrobenzoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione (PubChem CID 51451800) has the molecular formula C16H12N4O5 and a molecular weight of 340.30 g/mol. Its IUPAC name is (1R,2S,6R,7R)-7-(3-nitrobenzoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-7-(3-nitrobenzoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
|---|---|
| PubChem CID | 51451800 |
| Molecular Formula | C16H12N4O5 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (1R,2S,6R,7R)-7-(3-nitrobenzoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
| SMILES | O=C1NC(=O)[C@H]2[C@@H]1[C@H](C(=O)c1cccc([N+](=O)[O-])c1)N1N=CC=C[C@H]21 |
| InChI | InChI=1S/C16H12N4O5/c21-14(8-3-1-4-9(7-8)20(24)25)13-12-11(15(22)18-16(12)23)10-5-2-6-17-19(10)13/h1-7,10-13H,(H,18,22,23)/t10-,11-,12-,13-/m1/s1 |
| InChIKey | GIMUVRCWIHSISC-FDYHWXHSSA-N |
| XLogP | 0.27 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|