C33H21FN2O5 — CID 3717142
2-(4-fluorophenyl)-1-(3-nitrobenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 3717142) has the molecular formula C33H21FN2O5 and a molecular weight of 544.54 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(3-nitrobenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | 2-(4-fluorophenyl)-1-(3-nitrobenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 3717142 |
| Molecular Formula | C33H21FN2O5 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(3-nitrobenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)C1C(c2ccc(F)cc2)C2(C(=O)c3ccccc3C2=O)C2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C33H21FN2O5/c34-22-15-12-20(13-16-22)28-29(30(37)21-7-5-8-23(18-21)36(40)41)35-26-11-4-1-6-19(26)14-17-27(35)33(28)31(38)24-9-2-3-10-25(24)32(33)39/h1-18,27-29H |
| InChIKey | STPRZDKAIOEILG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|