C28H20N2O5 — CID 1422728
(1S,2S,3aS)-1-acetyl-2-(3-nitrophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 1422728) has the molecular formula C28H20N2O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is (1S,2S,3aS)-1-acetyl-2-(3-nitrophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1S,2S,3aS)-1-acetyl-2-(3-nitrophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 1422728 |
| Molecular Formula | C28H20N2O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (1S,2S,3aS)-1-acetyl-2-(3-nitrophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | CC(=O)[C@@H]1[C@@H](c2cccc([N+](=O)[O-])c2)C2(C(=O)c3ccccc3C2=O)[C@@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C28H20N2O5/c1-16(31)25-24(18-8-6-9-19(15-18)30(34)35)28(26(32)20-10-3-4-11-21(20)27(28)33)23-14-13-17-7-2-5-12-22(17)29(23)25/h2-15,23-25H,1H3/t23-,24+,25+/m0/s1 |
| InChIKey | IDBSBQDPYUOEJN-ISJGIBHGSA-N |
| XLogP | 4.62 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|