C29H23NO4 — CID 3490311
1-acetyl-2-(4-methoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 3490311) has the molecular formula C29H23NO4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-acetyl-2-(4-methoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | 1-acetyl-2-(4-methoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 3490311 |
| Molecular Formula | C29H23NO4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 1-acetyl-2-(4-methoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | COc1ccc(C2C(C(C)=O)N3c4ccccc4C=CC3C23C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C29H23NO4/c1-17(31)26-25(19-11-14-20(34-2)15-12-19)29(27(32)21-8-4-5-9-22(21)28(29)33)24-16-13-18-7-3-6-10-23(18)30(24)26/h3-16,24-26H,1-2H3 |
| InChIKey | WUTWBAGRLZOVEL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|