C29H23NO5 — CID 3832569
methyl 2-(4-methoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate (PubChem CID 3832569) has the molecular formula C29H23NO5 and a molecular weight of 465.51 g/mol. Its IUPAC name is methyl 2-(4-methoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate.
| Compound Name | methyl 2-(4-methoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate |
|---|---|
| PubChem CID | 3832569 |
| Molecular Formula | C29H23NO5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | methyl 2-(4-methoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate |
| SMILES | COC(=O)C1C(c2ccc(OC)cc2)C2(C(=O)c3ccccc3C2=O)C2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C29H23NO5/c1-34-19-14-11-18(12-15-19)24-25(28(33)35-2)30-22-10-6-3-7-17(22)13-16-23(30)29(24)26(31)20-8-4-5-9-21(20)27(29)32/h3-16,23-25H,1-2H3 |
| InChIKey | MWQNMRAKXGFYHQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|