C28H20FNO4 — CID 3885640
methyl 2-(2-fluorophenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate (PubChem CID 3885640) has the molecular formula C28H20FNO4 and a molecular weight of 453.47 g/mol. Its IUPAC name is methyl 2-(2-fluorophenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate.
| Compound Name | methyl 2-(2-fluorophenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate |
|---|---|
| PubChem CID | 3885640 |
| Molecular Formula | C28H20FNO4 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | methyl 2-(2-fluorophenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate |
| SMILES | COC(=O)C1C(c2ccccc2F)C2(C(=O)c3ccccc3C2=O)C2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C28H20FNO4/c1-34-27(33)24-23(19-11-5-6-12-20(19)29)28(25(31)17-9-3-4-10-18(17)26(28)32)22-15-14-16-8-2-7-13-21(16)30(22)24/h2-15,22-24H,1H3 |
| InChIKey | UNRWXJOPXCZARZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|