C31H27NO5 — CID 3363103
ethyl 2-(2-ethoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate (PubChem CID 3363103) has the molecular formula C31H27NO5 and a molecular weight of 493.56 g/mol. Its IUPAC name is ethyl 2-(2-ethoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate.
| Compound Name | ethyl 2-(2-ethoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate |
|---|---|
| PubChem CID | 3363103 |
| Molecular Formula | C31H27NO5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | ethyl 2-(2-ethoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2OCC)C2(C(=O)c3ccccc3C2=O)C2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C31H27NO5/c1-3-36-24-16-10-8-14-22(24)26-27(30(35)37-4-2)32-23-15-9-5-11-19(23)17-18-25(32)31(26)28(33)20-12-6-7-13-21(20)29(31)34/h5-18,25-27H,3-4H2,1-2H3 |
| InChIKey | SUMXYCURLOGNBG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|