C35H27NO4 — CID 92507256
(1R,2S,3aS)-1-benzoyl-2-(2-ethoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 92507256) has the molecular formula C35H27NO4 and a molecular weight of 525.60 g/mol. Its IUPAC name is (1R,2S,3aS)-1-benzoyl-2-(2-ethoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1R,2S,3aS)-1-benzoyl-2-(2-ethoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 92507256 |
| Molecular Formula | C35H27NO4 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | (1R,2S,3aS)-1-benzoyl-2-(2-ethoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | CCOc1ccccc1[C@@H]1[C@H](C(=O)c2ccccc2)N2c3ccccc3C=C[C@H]2C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C35H27NO4/c1-2-40-28-19-11-9-17-26(28)30-31(32(37)23-13-4-3-5-14-23)36-27-18-10-6-12-22(27)20-21-29(36)35(30)33(38)24-15-7-8-16-25(24)34(35)39/h3-21,29-31H,2H2,1H3/t29-,30+,31+/m0/s1 |
| InChIKey | CAFMMSRTIRABLN-OJDZSJEKSA-N |
| XLogP | 6.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|