C32H24N2O4 — CID 41012654
[(1S,2S,3R,3aS)-1-(3-nitrobenzoyl)-2-phenyl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-3-yl]-phenylmethanone (PubChem CID 41012654) has the molecular formula C32H24N2O4 and a molecular weight of 500.55 g/mol. Its IUPAC name is [(1S,2S,3R,3aS)-1-(3-nitrobenzoyl)-2-phenyl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-3-yl]-phenylmethanone.
| Compound Name | [(1S,2S,3R,3aS)-1-(3-nitrobenzoyl)-2-phenyl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 41012654 |
| Molecular Formula | C32H24N2O4 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | [(1S,2S,3R,3aS)-1-(3-nitrobenzoyl)-2-phenyl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](c2ccccc2)[C@@H](C(=O)c2cccc([N+](=O)[O-])c2)N2c3ccccc3C=C[C@@H]12 |
| InChI | InChI=1S/C32H24N2O4/c35-31(23-13-5-2-6-14-23)29-27-19-18-21-10-7-8-17-26(21)33(27)30(28(29)22-11-3-1-4-12-22)32(36)24-15-9-16-25(20-24)34(37)38/h1-20,27-30H/t27-,28+,29-,30-/m0/s1 |
| InChIKey | NMHDINZUWSXCHF-XJYHXZFBSA-N |
| XLogP | 6.34 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|