C33H23N3O5 — CID 124779056
(1'S,2'R,3R,3'aR)-2'-benzoyl-1'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 124779056) has the molecular formula C33H23N3O5 and a molecular weight of 541.56 g/mol. Its IUPAC name is (1'S,2'R,3R,3'aR)-2'-benzoyl-1'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'R,3R,3'aR)-2'-benzoyl-1'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 124779056 |
| Molecular Formula | C33H23N3O5 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | (1'S,2'R,3R,3'aR)-2'-benzoyl-1'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)[C@@H]1[C@H](C(=O)c2ccccc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C33H23N3O5/c37-30(21-10-2-1-3-11-21)28-29(31(38)22-12-8-13-23(19-22)36(40)41)35-26-16-7-4-9-20(26)17-18-27(35)33(28)24-14-5-6-15-25(24)34-32(33)39/h1-19,27-29H,(H,34,39)/t27-,28-,29+,33-/m1/s1 |
| InChIKey | ARFPDNHPVKDBPQ-NBJHOTSESA-N |
| XLogP | 5.45 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|