C32H22N4O5 — CID 6589148
(1'S,2'R,3R,3'aR)-1'-(4-nitrobenzoyl)-2'-(pyridine-4-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 6589148) has the molecular formula C32H22N4O5 and a molecular weight of 542.55 g/mol. Its IUPAC name is (1'S,2'R,3R,3'aR)-1'-(4-nitrobenzoyl)-2'-(pyridine-4-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'R,3R,3'aR)-1'-(4-nitrobenzoyl)-2'-(pyridine-4-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 6589148 |
| Molecular Formula | C32H22N4O5 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | (1'S,2'R,3R,3'aR)-1'-(4-nitrobenzoyl)-2'-(pyridine-4-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)[C@@H]1[C@H](C(=O)c2ccncc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C32H22N4O5/c37-29(21-15-17-33-18-16-21)27-28(30(38)20-9-12-22(13-10-20)36(40)41)35-25-8-4-1-5-19(25)11-14-26(35)32(27)23-6-2-3-7-24(23)34-31(32)39/h1-18,26-28H,(H,34,39)/t26-,27-,28+,32-/m1/s1 |
| InChIKey | GAPOEWQYCCWKTE-YSGXDJDMSA-N |
| XLogP | 4.85 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|