C36H29N3O5 — CID 98435348
(1'S,2'R,3S,3'aR)-1'-(4-nitrobenzoyl)-2'-(4-propylbenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 98435348) has the molecular formula C36H29N3O5 and a molecular weight of 583.64 g/mol. Its IUPAC name is (1'S,2'R,3S,3'aR)-1'-(4-nitrobenzoyl)-2'-(4-propylbenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'R,3S,3'aR)-1'-(4-nitrobenzoyl)-2'-(4-propylbenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 98435348 |
| Molecular Formula | C36H29N3O5 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | (1'S,2'R,3S,3'aR)-1'-(4-nitrobenzoyl)-2'-(4-propylbenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | CCCc1ccc(C(=O)[C@H]2[C@@H](C(=O)c3ccc([N+](=O)[O-])cc3)N3c4ccccc4C=C[C@@H]3[C@]23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C36H29N3O5/c1-2-7-22-12-14-24(15-13-22)33(40)31-32(34(41)25-16-19-26(20-17-25)39(43)44)38-29-11-6-3-8-23(29)18-21-30(38)36(31)27-9-4-5-10-28(27)37-35(36)42/h3-6,8-21,30-32H,2,7H2,1H3,(H,37,42)/t30-,31-,32+,36+/m1/s1 |
| InChIKey | XNSAOEIVFPMTFN-HXBWQCRLSA-N |
| XLogP | 6.40 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|