C31H21N3O5S — CID 1418171
(1'S,2'S,3R,3'aR)-1'-(4-nitrobenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 1418171) has the molecular formula C31H21N3O5S and a molecular weight of 547.59 g/mol. Its IUPAC name is (1'S,2'S,3R,3'aR)-1'-(4-nitrobenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'S,3R,3'aR)-1'-(4-nitrobenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 1418171 |
| Molecular Formula | C31H21N3O5S |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | (1'S,2'S,3R,3'aR)-1'-(4-nitrobenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)[C@@H]1[C@@H](C(=O)c2cccs2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C31H21N3O5S/c35-28(19-11-14-20(15-12-19)34(38)39)27-26(29(36)24-10-5-17-40-24)31(21-7-2-3-8-22(21)32-30(31)37)25-16-13-18-6-1-4-9-23(18)33(25)27/h1-17,25-27H,(H,32,37)/t25-,26+,27+,31-/m1/s1 |
| InChIKey | ITCOWSBAYTXBHQ-ANOKCIKSSA-N |
| XLogP | 5.51 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|