C34H25N3O5 — CID 4921240
1'-benzoyl-8'-methyl-2'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 4921240) has the molecular formula C34H25N3O5 and a molecular weight of 555.59 g/mol. Its IUPAC name is 1'-benzoyl-8'-methyl-2'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | 1'-benzoyl-8'-methyl-2'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 4921240 |
| Molecular Formula | C34H25N3O5 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 1'-benzoyl-8'-methyl-2'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | Cc1ccc2c(c1)N1C(C(=O)c3ccccc3)C(C(=O)c3cccc([N+](=O)[O-])c3)C3(C(=O)Nc4ccccc43)C1C=C2 |
| InChI | InChI=1S/C34H25N3O5/c1-20-14-15-21-16-17-28-34(25-12-5-6-13-26(25)35-33(34)40)29(31(38)23-10-7-11-24(19-23)37(41)42)30(36(28)27(21)18-20)32(39)22-8-3-2-4-9-22/h2-19,28-30H,1H3,(H,35,40) |
| InChIKey | SETJNAPNEKCWEW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|