C34H24N4O7 — CID 124826991
(1'S,2'R,3R,3'aS)-5'-methyl-2'-(3-nitrobenzoyl)-1'-(4-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 124826991) has the molecular formula C34H24N4O7 and a molecular weight of 600.59 g/mol. Its IUPAC name is (1'S,2'R,3R,3'aS)-5'-methyl-2'-(3-nitrobenzoyl)-1'-(4-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'R,3R,3'aS)-5'-methyl-2'-(3-nitrobenzoyl)-1'-(4-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 124826991 |
| Molecular Formula | C34H24N4O7 |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | (1'S,2'R,3R,3'aS)-5'-methyl-2'-(3-nitrobenzoyl)-1'-(4-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | CC1=C[C@@H]2N(c3ccccc31)[C@H](C(=O)c1ccc([N+](=O)[O-])cc1)[C@H](C(=O)c1cccc([N+](=O)[O-])c1)[C@]21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C34H24N4O7/c1-19-17-28-34(25-10-3-4-11-26(25)35-33(34)41)29(31(39)21-7-6-8-23(18-21)38(44)45)30(36(28)27-12-5-2-9-24(19)27)32(40)20-13-15-22(16-14-20)37(42)43/h2-18,28-30H,1H3,(H,35,41)/t28-,29+,30-,34+/m0/s1 |
| InChIKey | CELMTJHKWOYMKC-CTMYTVLESA-N |
| XLogP | 5.75 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|