C34H24ClN3O5 — CID 4976621
1'-(4-chlorobenzoyl)-5'-methyl-2'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 4976621) has the molecular formula C34H24ClN3O5 and a molecular weight of 590.04 g/mol. Its IUPAC name is 1'-(4-chlorobenzoyl)-5'-methyl-2'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | 1'-(4-chlorobenzoyl)-5'-methyl-2'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 4976621 |
| Molecular Formula | C34H24ClN3O5 |
| Molecular Weight | 590.04 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | 1'-(4-chlorobenzoyl)-5'-methyl-2'-(3-nitrobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | CC1=CC2N(c3ccccc31)C(C(=O)c1ccc(Cl)cc1)C(C(=O)c1cccc([N+](=O)[O-])c1)C21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C34H24ClN3O5/c1-19-17-28-34(25-10-3-4-11-26(25)36-33(34)41)29(31(39)21-7-6-8-23(18-21)38(42)43)30(32(40)20-13-15-22(35)16-14-20)37(28)27-12-5-2-9-24(19)27/h2-18,28-30H,1H3,(H,36,41) |
| InChIKey | UTSKPBSVUGXZSY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.04 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|