C25H19ClN2O3 — CID 51665477
[(1S,2S,3S,3aR)-2-(4-chlorophenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-phenylmethanone (PubChem CID 51665477) has the molecular formula C25H19ClN2O3 and a molecular weight of 430.89 g/mol. Its IUPAC name is [(1S,2S,3S,3aR)-2-(4-chlorophenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-phenylmethanone.
| Compound Name | [(1S,2S,3S,3aR)-2-(4-chlorophenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 51665477 |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [(1S,2S,3S,3aR)-2-(4-chlorophenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@H](c2ccc(Cl)cc2)[C@H]([N+](=O)[O-])[C@H]2C=Cc3ccccc3N21 |
| InChI | InChI=1S/C25H19ClN2O3/c26-19-13-10-17(11-14-19)22-23(28(30)31)21-15-12-16-6-4-5-9-20(16)27(21)24(22)25(29)18-7-2-1-3-8-18/h1-15,21-24H/t21-,22-,23-,24+/m1/s1 |
| InChIKey | CYEKNJZMUKWCPH-YCAMKHIRSA-N |
| XLogP | 5.24 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|