C26H23ClN2O4 — CID 98446657
(10R,11S,15S,16R)-16-(4-chlorobenzoyl)-13-[[(2S)-oxolan-2-yl]methyl]-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 98446657) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is (10R,11S,15S,16R)-16-(4-chlorobenzoyl)-13-[[(2S)-oxolan-2-yl]methyl]-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11S,15S,16R)-16-(4-chlorobenzoyl)-13-[[(2S)-oxolan-2-yl]methyl]-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 98446657 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (10R,11S,15S,16R)-16-(4-chlorobenzoyl)-13-[[(2S)-oxolan-2-yl]methyl]-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | O=C(c1ccc(Cl)cc1)[C@H]1[C@H]2C(=O)N(C[C@@H]3CCCO3)C(=O)[C@@H]2[C@H]2C=Cc3ccccc3N21 |
| InChI | InChI=1S/C26H23ClN2O4/c27-17-10-7-16(8-11-17)24(30)23-22-21(20-12-9-15-4-1-2-6-19(15)29(20)23)25(31)28(26(22)32)14-18-5-3-13-33-18/h1-2,4,6-12,18,20-23H,3,5,13-14H2/t18-,20+,21+,22-,23+/m0/s1 |
| InChIKey | COKPZRLPVOQTPL-PBZQEHOFSA-N |
| XLogP | 3.59 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|