C17H17NO4 — CID 102472593
methyl 2-[(3aS,5S,7aR)-1,3-dioxo-2-phenyl-3a,4,5,7a-tetrahydroisoindol-5-yl]acetate (PubChem CID 102472593) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl 2-[(3aS,5S,7aR)-1,3-dioxo-2-phenyl-3a,4,5,7a-tetrahydroisoindol-5-yl]acetate.
| Compound Name | methyl 2-[(3aS,5S,7aR)-1,3-dioxo-2-phenyl-3a,4,5,7a-tetrahydroisoindol-5-yl]acetate |
|---|---|
| PubChem CID | 102472593 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl 2-[(3aS,5S,7aR)-1,3-dioxo-2-phenyl-3a,4,5,7a-tetrahydroisoindol-5-yl]acetate |
| SMILES | COC(=O)C[C@H]1C=C[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C17H17NO4/c1-22-15(19)10-11-7-8-13-14(9-11)17(21)18(16(13)20)12-5-3-2-4-6-12/h2-8,11,13-14H,9-10H2,1H3/t11-,13+,14-/m0/s1 |
| InChIKey | LVQYZFHBRLYVAM-YUTCNCBUSA-N |
| XLogP | 1.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|