C20H19NO7 — CID 101401923
methyl (1R,2R,6R,7R)-10,10-dimethoxy-3,5,11-trioxo-4-phenyl-4-azatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate (PubChem CID 101401923) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is methyl (1R,2R,6R,7R)-10,10-dimethoxy-3,5,11-trioxo-4-phenyl-4-azatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate.
| Compound Name | methyl (1R,2R,6R,7R)-10,10-dimethoxy-3,5,11-trioxo-4-phenyl-4-azatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 101401923 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | methyl (1R,2R,6R,7R)-10,10-dimethoxy-3,5,11-trioxo-4-phenyl-4-azatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2[C@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3[C@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C20H19NO7/c1-26-19(25)11-9-12-14-15(13(11)16(22)20(12,27-2)28-3)18(24)21(17(14)23)10-7-5-4-6-8-10/h4-9,12-15H,1-3H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | RSSFTXRKRNXKKC-LXTVHRRPSA-N |
| XLogP | 0.71 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|