C17H15Br2NO4 — CID 85387937
8,9-dibromo-10,10-dimethoxy-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 85387937) has the molecular formula C17H15Br2NO4 and a molecular weight of 457.12 g/mol. Its IUPAC name is 8,9-dibromo-10,10-dimethoxy-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 8,9-dibromo-10,10-dimethoxy-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 85387937 |
| Molecular Formula | C17H15Br2NO4 |
| Molecular Weight | 457.12 g/mol |
| Exact Mass | 454.94 |
| IUPAC Name | 8,9-dibromo-10,10-dimethoxy-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COC1(OC)C2C(Br)=C(Br)C1C1C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C17H15Br2NO4/c1-23-17(24-2)11-9-10(12(17)14(19)13(11)18)16(22)20(15(9)21)8-6-4-3-5-7-8/h3-7,9-12H,1-2H3 |
| InChIKey | WKYJFYQOUDRGFE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|