C18H16N2O3 — CID 124798273
(1S,2R,6R,7S,8R,11S)-10-methoxy-4-phenyl-4,9-diazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione (PubChem CID 124798273) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,11S)-10-methoxy-4-phenyl-4,9-diazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione.
| Compound Name | (1S,2R,6R,7S,8R,11S)-10-methoxy-4-phenyl-4,9-diazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
|---|---|
| PubChem CID | 124798273 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (1S,2R,6R,7S,8R,11S)-10-methoxy-4-phenyl-4,9-diazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
| SMILES | COC1=N[C@@H]2[C@H]3C=C[C@H]([C@H]4C(=O)N(c5ccccc5)C(=O)[C@H]34)[C@H]12 |
| InChI | InChI=1S/C18H16N2O3/c1-23-16-14-10-7-8-11(15(14)19-16)13-12(10)17(21)20(18(13)22)9-5-3-2-4-6-9/h2-8,10-15H,1H3/t10-,11+,12-,13-,14+,15-/m1/s1 |
| InChIKey | XWNXJJMUULZBPK-ZAQNNHEOSA-N |
| XLogP | 1.65 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|