C28H24N2O6 — CID 98053357
(1R,2R,3R,7R,8R,9R,10S,14S)-5,12-bis(3-methoxyphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone (PubChem CID 98053357) has the molecular formula C28H24N2O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is (1R,2R,3R,7R,8R,9R,10S,14S)-5,12-bis(3-methoxyphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone.
| Compound Name | (1R,2R,3R,7R,8R,9R,10S,14S)-5,12-bis(3-methoxyphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 98053357 |
| Molecular Formula | C28H24N2O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (1R,2R,3R,7R,8R,9R,10S,14S)-5,12-bis(3-methoxyphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
| SMILES | COc1cccc(N2C(=O)[C@H]3[C@@H]4C=C[C@@H]([C@@H]3C2=O)[C@H]2[C@H]3C(=O)N(c5cccc(OC)c5)C(=O)[C@@H]3[C@H]42)c1 |
| InChI | InChI=1S/C28H24N2O6/c1-35-15-7-3-5-13(11-15)29-25(31)21-17-9-10-18(22(21)26(29)32)20-19(17)23-24(20)28(34)30(27(23)33)14-6-4-8-16(12-14)36-2/h3-12,17-24H,1-2H3/t17-,18-,19-,20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | HYMMFONVODQVGL-HKHZPIFNSA-N |
| XLogP | 2.68 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|