C28H24N2O6 — CID 124722645
(1S,2R,3S,7S,8S,9R,10S,14R)-5,12-bis(2-methoxyphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone (PubChem CID 124722645) has the molecular formula C28H24N2O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is (1S,2R,3S,7S,8S,9R,10S,14R)-5,12-bis(2-methoxyphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone.
| Compound Name | (1S,2R,3S,7S,8S,9R,10S,14R)-5,12-bis(2-methoxyphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 124722645 |
| Molecular Formula | C28H24N2O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (1S,2R,3S,7S,8S,9R,10S,14R)-5,12-bis(2-methoxyphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
| SMILES | COc1ccccc1N1C(=O)[C@@H]2[C@@H](C1=O)[C@@H]1[C@@H]3C=C[C@@H]([C@@H]4C(=O)N(c5ccccc5OC)C(=O)[C@H]34)[C@H]21 |
| InChI | InChI=1S/C28H24N2O6/c1-35-17-9-5-3-7-15(17)29-25(31)21-13-11-12-14(22(21)26(29)32)20-19(13)23-24(20)28(34)30(27(23)33)16-8-4-6-10-18(16)36-2/h3-14,19-24H,1-2H3/t13-,14+,19+,20-,21+,22-,23-,24-/m0/s1 |
| InChIKey | RRIOTUWEOZDUOK-FMQZARBUSA-N |
| XLogP | 2.68 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|