C28H24N2O4 — CID 98121218
(1R,2R,3R,7R,8R,9R,10S,14R)-5,12-bis(2-methylphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone (PubChem CID 98121218) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is (1R,2R,3R,7R,8R,9R,10S,14R)-5,12-bis(2-methylphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone.
| Compound Name | (1R,2R,3R,7R,8R,9R,10S,14R)-5,12-bis(2-methylphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 98121218 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (1R,2R,3R,7R,8R,9R,10S,14R)-5,12-bis(2-methylphenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
| SMILES | Cc1ccccc1N1C(=O)[C@@H]2[C@@H]3C=C[C@@H]([C@@H]2C1=O)[C@H]1[C@H]2C(=O)N(c4ccccc4C)C(=O)[C@@H]2[C@H]31 |
| InChI | InChI=1S/C28H24N2O4/c1-13-7-3-5-9-17(13)29-25(31)21-15-11-12-16(22(21)26(29)32)20-19(15)23-24(20)28(34)30(27(23)33)18-10-6-4-8-14(18)2/h3-12,15-16,19-24H,1-2H3/t15-,16-,19-,20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | DAPPNHWZEJNIAA-WYQOWTGZSA-N |
| XLogP | 3.28 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|