C22H23NO2 — CID 23328178
(1S,2S,6R,7S)-10-cyclohexylidene-4-(2-methylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 23328178) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (1S,2S,6R,7S)-10-cyclohexylidene-4-(2-methylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7S)-10-cyclohexylidene-4-(2-methylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 23328178 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (1S,2S,6R,7S)-10-cyclohexylidene-4-(2-methylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1ccccc1N1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@@H]2C1=C1CCCCC1 |
| InChI | InChI=1S/C22H23NO2/c1-13-7-5-6-10-17(13)23-21(24)19-15-11-12-16(20(19)22(23)25)18(15)14-8-3-2-4-9-14/h5-7,10-12,15-16,19-20H,2-4,8-9H2,1H3/t15-,16-,19-,20+/m1/s1 |
| InChIKey | RIZSTACIMQUWKD-SMOSDQRPSA-N |
| XLogP | 4.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|