C18H14FNO2 — CID 101188190
(1R,2R,6S,7S,8S,11R)-4-(2-fluorophenyl)-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione (PubChem CID 101188190) has the molecular formula C18H14FNO2 and a molecular weight of 295.31 g/mol. Its IUPAC name is (1R,2R,6S,7S,8S,11R)-4-(2-fluorophenyl)-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione.
| Compound Name | (1R,2R,6S,7S,8S,11R)-4-(2-fluorophenyl)-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
|---|---|
| PubChem CID | 101188190 |
| Molecular Formula | C18H14FNO2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (1R,2R,6S,7S,8S,11R)-4-(2-fluorophenyl)-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3C=C[C@@H]([C@H]4C=C[C@H]43)[C@@H]2C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C18H14FNO2/c19-13-3-1-2-4-14(13)20-17(21)15-11-7-8-12(16(15)18(20)22)10-6-5-9(10)11/h1-12,15-16H/t9-,10+,11-,12+,15-,16+ |
| InChIKey | RCHVDIRRVCKTRE-PJCOKBIESA-N |
| XLogP | 2.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|