C21H27NO3Si — CID 101036153
(1R,2S,6R,7R)-10,10-dimethyl-4-phenyl-8-trimethylsilyloxy-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 101036153) has the molecular formula C21H27NO3Si and a molecular weight of 369.54 g/mol. Its IUPAC name is (1R,2S,6R,7R)-10,10-dimethyl-4-phenyl-8-trimethylsilyloxy-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-10,10-dimethyl-4-phenyl-8-trimethylsilyloxy-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 101036153 |
| Molecular Formula | C21H27NO3Si |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (1R,2S,6R,7R)-10,10-dimethyl-4-phenyl-8-trimethylsilyloxy-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | CC1(C)C[C@H]2C(O[Si](C)(C)C)=C[C@@H]1[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H27NO3Si/c1-21(2)12-14-16(25-26(3,4)5)11-15(21)18-17(14)19(23)22(20(18)24)13-9-7-6-8-10-13/h6-11,14-15,17-18H,12H2,1-5H3/t14-,15+,17+,18-/m0/s1 |
| InChIKey | RXBCJNSXXXALPE-IDCNUPLLSA-N |
| XLogP | 4.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|