C14H13NO5 — CID 11572630
(4R,5R,6S,7S)-5,6-dihydroxy-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 11572630) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is (4R,5R,6S,7S)-5,6-dihydroxy-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (4R,5R,6S,7S)-5,6-dihydroxy-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 11572630 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (4R,5R,6S,7S)-5,6-dihydroxy-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1C2C(C(=O)N1c1ccccc1)[C@@H]1O[C@H]2[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H13NO5/c16-9-10(17)12-8-7(11(9)20-12)13(18)15(14(8)19)6-4-2-1-3-5-6/h1-5,7-12,16-17H/t7?,8?,9-,10+,11-,12+ |
| InChIKey | DQQIQBGIEFFYBA-QSTBHEHHSA-N |
| XLogP | -0.70 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|