C16H13NO4 — CID 98343423
(1R,2R,6R,7S)-4-phenyl-4-azatricyclo[5.2.2.02,6]undecane-3,5,8,10-tetrone (PubChem CID 98343423) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is (1R,2R,6R,7S)-4-phenyl-4-azatricyclo[5.2.2.02,6]undecane-3,5,8,10-tetrone.
| Compound Name | (1R,2R,6R,7S)-4-phenyl-4-azatricyclo[5.2.2.02,6]undecane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 98343423 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (1R,2R,6R,7S)-4-phenyl-4-azatricyclo[5.2.2.02,6]undecane-3,5,8,10-tetrone |
| SMILES | O=C1C[C@H]2C(=O)C[C@H]1[C@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H13NO4/c18-11-6-9-12(19)7-10(11)14-13(9)15(20)17(16(14)21)8-4-2-1-3-5-8/h1-5,9-10,13-14H,6-7H2/t9-,10+,13-,14-/m1/s1 |
| InChIKey | FYBYTIAYCLNTRP-RDBQEKCUSA-N |
| XLogP | 0.97 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|