C17H14ClNO4 — CID 98141193
(1R,2S,6R,7S)-4-(3-chloro-4-methylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8,10-tetrone (PubChem CID 98141193) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-(3-chloro-4-methylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8,10-tetrone.
| Compound Name | (1R,2S,6R,7S)-4-(3-chloro-4-methylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 98141193 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (1R,2S,6R,7S)-4-(3-chloro-4-methylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8,10-tetrone |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2CC(=O)[C@@H]3CC2=O)cc1Cl |
| InChI | InChI=1S/C17H14ClNO4/c1-7-2-3-8(4-11(7)18)19-16(22)14-9-5-12(20)10(6-13(9)21)15(14)17(19)23/h2-4,9-10,14-15H,5-6H2,1H3/t9-,10+,14-,15+ |
| InChIKey | QVXSDPZASGYXCG-LMHVJCSRSA-N |
| XLogP | 1.93 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|