C36H28Cl2N2O4 — CID 124719411
(1R,2R,3R,7R,11S,12R,16S)-5,14-bis(3-chloro-4-methylphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone (PubChem CID 124719411) has the molecular formula C36H28Cl2N2O4 and a molecular weight of 623.54 g/mol. Its IUPAC name is (1R,2R,3R,7R,11S,12R,16S)-5,14-bis(3-chloro-4-methylphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone.
| Compound Name | (1R,2R,3R,7R,11S,12R,16S)-5,14-bis(3-chloro-4-methylphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone |
|---|---|
| PubChem CID | 124719411 |
| Molecular Formula | C36H28Cl2N2O4 |
| Molecular Weight | 623.54 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | (1R,2R,3R,7R,11S,12R,16S)-5,14-bis(3-chloro-4-methylphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@@H]4C=C[C@H](C5=C(c6ccccc6)C[C@H]6C(=O)N(c7ccc(C)c(Cl)c7)C(=O)[C@@H]6[C@H]54)[C@H]3C2=O)cc1Cl |
| InChI | InChI=1S/C36H28Cl2N2O4/c1-17-8-10-20(14-26(17)37)39-33(41)25-16-24(19-6-4-3-5-7-19)28-22-12-13-23(29(28)32(25)36(39)44)31-30(22)34(42)40(35(31)43)21-11-9-18(2)27(38)15-21/h3-15,22-23,25,29-32H,16H2,1-2H3/t22-,23-,25-,29+,30-,31+,32+/m1/s1 |
| InChIKey | HBPYFEDUIBVUNN-FYYWNGOWSA-N |
| XLogP | 6.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|