C38H34N2O4 — CID 124822712
(1R,2S,3S,7R,11S,12R,16S)-5,14-bis(3,4-dimethylphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone (PubChem CID 124822712) has the molecular formula C38H34N2O4 and a molecular weight of 582.70 g/mol. Its IUPAC name is (1R,2S,3S,7R,11S,12R,16S)-5,14-bis(3,4-dimethylphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone.
| Compound Name | (1R,2S,3S,7R,11S,12R,16S)-5,14-bis(3,4-dimethylphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone |
|---|---|
| PubChem CID | 124822712 |
| Molecular Formula | C38H34N2O4 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | (1R,2S,3S,7R,11S,12R,16S)-5,14-bis(3,4-dimethylphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@@H]4C=C[C@H](C5=C(c6ccccc6)C[C@H]6C(=O)N(c7ccc(C)c(C)c7)C(=O)[C@H]6[C@@H]54)[C@H]3C2=O)cc1C |
| InChI | InChI=1S/C38H34N2O4/c1-19-10-12-24(16-21(19)3)39-35(41)29-18-28(23-8-6-5-7-9-23)30-26-14-15-27(31(30)34(29)38(39)44)33-32(26)36(42)40(37(33)43)25-13-11-20(2)22(4)17-25/h5-17,26-27,29,31-34H,18H2,1-4H3/t26-,27-,29-,31-,32-,33+,34-/m1/s1 |
| InChIKey | ZOWUCCIABGWVCI-ZJIIRUDOSA-N |
| XLogP | 6.12 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|