C38H34N2O6 — CID 99723793
(1R,2R,3S,7R,11S,12R,16S)-5,14-bis(4-ethoxyphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone (PubChem CID 99723793) has the molecular formula C38H34N2O6 and a molecular weight of 614.70 g/mol. Its IUPAC name is (1R,2R,3S,7R,11S,12R,16S)-5,14-bis(4-ethoxyphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone.
| Compound Name | (1R,2R,3S,7R,11S,12R,16S)-5,14-bis(4-ethoxyphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone |
|---|---|
| PubChem CID | 99723793 |
| Molecular Formula | C38H34N2O6 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | (1R,2R,3S,7R,11S,12R,16S)-5,14-bis(4-ethoxyphenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone |
| SMILES | CCOc1ccc(N2C(=O)[C@H]3[C@@H]4C=C[C@H](C5=C(c6ccccc6)C[C@H]6C(=O)N(c7ccc(OCC)cc7)C(=O)[C@H]6[C@H]54)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C38H34N2O6/c1-3-45-24-14-10-22(11-15-24)39-35(41)29-20-28(21-8-6-5-7-9-21)30-26-18-19-27(31(30)34(29)38(39)44)33-32(26)36(42)40(37(33)43)23-12-16-25(17-13-23)46-4-2/h5-19,26-27,29,31-34H,3-4,20H2,1-2H3/t26-,27-,29-,31+,32-,33+,34-/m1/s1 |
| InChIKey | LOKQTYDWRXNIJW-YYOXSAFTSA-N |
| XLogP | 5.68 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|