C34H24N4O8 — CID 124724162
(1R,2S,3S,7R,11S,12R,16S)-5,14-bis(3-nitrophenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone (PubChem CID 124724162) has the molecular formula C34H24N4O8 and a molecular weight of 616.59 g/mol. Its IUPAC name is (1R,2S,3S,7R,11S,12R,16S)-5,14-bis(3-nitrophenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone.
| Compound Name | (1R,2S,3S,7R,11S,12R,16S)-5,14-bis(3-nitrophenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone |
|---|---|
| PubChem CID | 124724162 |
| Molecular Formula | C34H24N4O8 |
| Molecular Weight | 616.59 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | (1R,2S,3S,7R,11S,12R,16S)-5,14-bis(3-nitrophenyl)-9-phenyl-5,14-diazapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-9,17-diene-4,6,13,15-tetrone |
| SMILES | O=C1[C@H]2[C@@H]3C=C[C@H](C4=C(c5ccccc5)C[C@H]5C(=O)N(c6cccc([N+](=O)[O-])c6)C(=O)[C@H]5[C@@H]43)[C@H]2C(=O)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H24N4O8/c39-31-25-16-24(17-6-2-1-3-7-17)26-22-12-13-23(27(26)30(25)34(42)35(31)18-8-4-10-20(14-18)37(43)44)29-28(22)32(40)36(33(29)41)19-9-5-11-21(15-19)38(45)46/h1-15,22-23,25,27-30H,16H2/t22-,23-,25-,27-,28-,29+,30-/m1/s1 |
| InChIKey | YFWYOSOEEHFARG-LFQOMDAQSA-N |
| XLogP | 4.70 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|