C18H22N2O2 — CID 15305445
(3aS,9aR,9bR)-9,9-dimethyl-2-phenyl-4,6,7,8,9a,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-1,3-dione (PubChem CID 15305445) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (3aS,9aR,9bR)-9,9-dimethyl-2-phenyl-4,6,7,8,9a,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-1,3-dione.
| Compound Name | (3aS,9aR,9bR)-9,9-dimethyl-2-phenyl-4,6,7,8,9a,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-1,3-dione |
|---|---|
| PubChem CID | 15305445 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (3aS,9aR,9bR)-9,9-dimethyl-2-phenyl-4,6,7,8,9a,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-1,3-dione |
| SMILES | CC1(C)CCCN2C[C@H]3C(=O)N(c4ccccc4)C(=O)[C@H]3[C@@H]21 |
| InChI | InChI=1S/C18H22N2O2/c1-18(2)9-6-10-19-11-13-14(15(18)19)17(22)20(16(13)21)12-7-4-3-5-8-12/h3-5,7-8,13-15H,6,9-11H2,1-2H3/t13-,14-,15-/m1/s1 |
| InChIKey | DTWAICOGMMGNNF-RBSFLKMASA-N |
| XLogP | 2.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|