C32H34N2O6Si — CID 10840801
(1S,2S,3R,7S,11S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-5,14-diphenyl-17-oxa-5,14-diazapentacyclo[9.5.1.02,10.03,7.012,16]heptadec-9-ene-4,6,13,15-tetrone (PubChem CID 10840801) has the molecular formula C32H34N2O6Si and a molecular weight of 570.72 g/mol. Its IUPAC name is (1S,2S,3R,7S,11S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-5,14-diphenyl-17-oxa-5,14-diazapentacyclo[9.5.1.02,10.03,7.012,16]heptadec-9-ene-4,6,13,15-tetrone.
| Compound Name | (1S,2S,3R,7S,11S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-5,14-diphenyl-17-oxa-5,14-diazapentacyclo[9.5.1.02,10.03,7.012,16]heptadec-9-ene-4,6,13,15-tetrone |
|---|---|
| PubChem CID | 10840801 |
| Molecular Formula | C32H34N2O6Si |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | (1S,2S,3R,7S,11S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-5,14-diphenyl-17-oxa-5,14-diazapentacyclo[9.5.1.02,10.03,7.012,16]heptadec-9-ene-4,6,13,15-tetrone |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2[C@@H]([C@@H]3O[C@H]2[C@H]2C(=O)N(c4ccccc4)C(=O)[C@@H]32)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C32H34N2O6Si/c1-32(2,3)41(4,5)40-20-16-19-21(29(36)33(28(19)35)17-12-8-6-9-13-17)23-22(20)26-24-25(27(23)39-26)31(38)34(30(24)37)18-14-10-7-11-15-18/h6-15,19,21,23-27H,16H2,1-5H3/t19-,21-,23-,24-,25+,26+,27-/m0/s1 |
| InChIKey | YWBWYVQLKDYDPM-WGNKXAHJSA-N |
| XLogP | 4.67 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|