C23H20N2O2 — CID 135047431
1-methyl-4,7-diphenyl-5,5a,8a,8b-tetrahydropyrrolo[3,4-g]indole-6,8-dione (PubChem CID 135047431) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-methyl-4,7-diphenyl-5,5a,8a,8b-tetrahydropyrrolo[3,4-g]indole-6,8-dione.
| Compound Name | 1-methyl-4,7-diphenyl-5,5a,8a,8b-tetrahydropyrrolo[3,4-g]indole-6,8-dione |
|---|---|
| PubChem CID | 135047431 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-methyl-4,7-diphenyl-5,5a,8a,8b-tetrahydropyrrolo[3,4-g]indole-6,8-dione |
| SMILES | CN1C=CC2=C(c3ccccc3)CC3C(=O)N(c4ccccc4)C(=O)C3C21 |
| InChI | InChI=1S/C23H20N2O2/c1-24-13-12-17-18(15-8-4-2-5-9-15)14-19-20(21(17)24)23(27)25(22(19)26)16-10-6-3-7-11-16/h2-13,19-21H,14H2,1H3 |
| InChIKey | NXPXEMPRBASUMI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|