C25H34N2O4Si — CID 24960686
5-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 24960686) has the molecular formula C25H34N2O4Si and a molecular weight of 454.64 g/mol. Its IUPAC name is 5-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 5-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 24960686 |
| Molecular Formula | C25H34N2O4Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 5-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)C1C(=O)NC1C1=CCC2C(=O)N(c3ccccc3)C(=O)C2C1 |
| InChI | InChI=1S/C25H34N2O4Si/c1-15(31-32(5,6)25(2,3)4)20-21(26-22(20)28)16-12-13-18-19(14-16)24(30)27(23(18)29)17-10-8-7-9-11-17/h7-12,15,18-21H,13-14H2,1-6H3,(H,26,28) |
| InChIKey | SYYKXVOTQFQGFP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|