C21H33NO6Si — CID 70793058
dimethyl 4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]cyclohexa-1,4-diene-1,2-dicarboxylate (PubChem CID 70793058) has the molecular formula C21H33NO6Si and a molecular weight of 423.58 g/mol. Its IUPAC name is dimethyl 4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]cyclohexa-1,4-diene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]cyclohexa-1,4-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70793058 |
| Molecular Formula | C21H33NO6Si |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | dimethyl 4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]cyclohexa-1,4-diene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC([C@H]2NC(=O)[C@@H]2[C@@H](C)O[Si](C)(C)C(C)(C)C)=CC1 |
| InChI | InChI=1S/C21H33NO6Si/c1-12(28-29(7,8)21(2,3)4)16-17(22-18(16)23)13-9-10-14(19(24)26-5)15(11-13)20(25)27-6/h9,12,16-17H,10-11H2,1-8H3,(H,22,23)/t12-,16-,17-/m1/s1 |
| InChIKey | YHXPRNJRVLDCRG-CSMYWGQOSA-N |
| XLogP | 2.87 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|