C23H35NO6Si — CID 11396755
dimethyl (1S,9bS)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,4,5,5a,8,9b-hexahydroazeto[2,1-a]isoquinoline-6,7-dicarboxylate (PubChem CID 11396755) has the molecular formula C23H35NO6Si and a molecular weight of 449.62 g/mol. Its IUPAC name is dimethyl (1S,9bS)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,4,5,5a,8,9b-hexahydroazeto[2,1-a]isoquinoline-6,7-dicarboxylate.
| Compound Name | dimethyl (1S,9bS)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,4,5,5a,8,9b-hexahydroazeto[2,1-a]isoquinoline-6,7-dicarboxylate |
|---|---|
| PubChem CID | 11396755 |
| Molecular Formula | C23H35NO6Si |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | dimethyl (1S,9bS)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,4,5,5a,8,9b-hexahydroazeto[2,1-a]isoquinoline-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2CCN3C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]3C2=CC1 |
| InChI | InChI=1S/C23H35NO6Si/c1-13(30-31(7,8)23(2,3)4)17-19-15-9-10-16(21(26)28-5)18(22(27)29-6)14(15)11-12-24(19)20(17)25/h9,13-14,17,19H,10-12H2,1-8H3/t13-,14?,17-,19-/m1/s1 |
| InChIKey | GPNWTJVYWIFBLP-UPFHGQHHSA-N |
| XLogP | 3.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|