C17H28BrNO4S2Si — CID 154413243
methyl (6R,7S)-3-(2-bromoethyl)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154413243) has the molecular formula C17H28BrNO4S2Si and a molecular weight of 482.54 g/mol. Its IUPAC name is methyl (6R,7S)-3-(2-bromoethyl)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | methyl (6R,7S)-3-(2-bromoethyl)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154413243 |
| Molecular Formula | C17H28BrNO4S2Si |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | methyl (6R,7S)-3-(2-bromoethyl)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=C(CCBr)SS[C@@H]2[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C17H28BrNO4S2Si/c1-10(23-26(6,7)17(2,3)4)12-14(20)19-13(16(21)22-5)11(8-9-18)24-25-15(12)19/h10,12,15H,8-9H2,1-7H3/t10-,12+,15-/m1/s1 |
| InChIKey | TUBXGRIOETYNKP-IFUGULHKSA-N |
| XLogP | 4.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|