C20H33NO6S2Si — CID 154413820
tert-butyl (6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(formyloxymethyl)-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154413820) has the molecular formula C20H33NO6S2Si and a molecular weight of 475.71 g/mol. Its IUPAC name is tert-butyl (6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(formyloxymethyl)-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(formyloxymethyl)-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154413820 |
| Molecular Formula | C20H33NO6S2Si |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | tert-butyl (6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(formyloxymethyl)-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2C(C(=O)OC(C)(C)C)=C(COC=O)SS[C@H]12 |
| InChI | InChI=1S/C20H33NO6S2Si/c1-12(27-30(8,9)20(5,6)7)14-16(23)21-15(18(24)26-19(2,3)4)13(10-25-11-22)28-29-17(14)21/h11-12,14,17H,10H2,1-9H3/t12-,14+,17-/m1/s1 |
| InChIKey | GNLWKNFNAXDLOQ-HACGYAERSA-N |
| XLogP | 4.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|