C30H41FeNO4SSi+2 — CID 45278232
CID 45278232 (PubChem CID 45278232) has the molecular formula C30H41FeNO4SSi+2 and a molecular weight of 595.66 g/mol.
| Compound Name | CID 45278232 |
|---|---|
| PubChem CID | 45278232 |
| Molecular Formula | C30H41FeNO4SSi+2 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)C1=C(CCC[C]2[CH][CH][CH][CH]2)S[C@@H]2[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N12.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C25H36NO4SSi.C5H5.Fe/c1-8-16-29-24(28)21-19(15-11-14-18-12-9-10-13-18)31-23-20(22(27)26(21)23)17(2)30-32(6,7)25(3,4)5;1-2-4-5-3-1;/h8-10,12-13,17,20,23H,1,11,14-16H2,2-7H3;1-5H;/q;;+2/t17-,20+,23-;;/m1../s1 |
| InChIKey | HYGUGGVUTADJHD-RAIHOUBBSA-N |
| XLogP | 6.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|