C18H29NO3S2Si — CID 139601889
O-prop-2-enyl (5R,6R)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate (PubChem CID 139601889) has the molecular formula C18H29NO3S2Si and a molecular weight of 399.65 g/mol. Its IUPAC name is O-prop-2-enyl (5R,6R)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate.
| Compound Name | O-prop-2-enyl (5R,6R)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 139601889 |
| Molecular Formula | C18H29NO3S2Si |
| Molecular Weight | 399.65 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | O-prop-2-enyl (5R,6R)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate |
| SMILES | C=CCOC(=S)C1=C(C)S[C@@H]2[C@H](C(C)O[Si](C)(C)C(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C18H29NO3S2Si/c1-9-10-21-17(23)14-12(3)24-16-13(15(20)19(14)16)11(2)22-25(7,8)18(4,5)6/h9,11,13,16H,1,10H2,2-8H3/t11?,13-,16-/m1/s1 |
| InChIKey | KEGOBPAWBUOROA-ZUZSALNQSA-N |
| XLogP | 4.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|