C23H25FeNO4S+2 — CID 45278397
CID 45278397 (PubChem CID 45278397) has the molecular formula C23H25FeNO4S+2 and a molecular weight of 467.37 g/mol.
| Compound Name | CID 45278397 |
|---|---|
| PubChem CID | 45278397 |
| Molecular Formula | C23H25FeNO4S+2 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)C1=C(CC[C]2[CH][CH][CH][CH]2)S[C@@H]2[C@@H]([C@@H](C)O)C(=O)N12.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C18H20NO4S.C5H5.Fe/c1-3-10-23-18(22)15-13(9-8-12-6-4-5-7-12)24-17-14(11(2)20)16(21)19(15)17;1-2-4-5-3-1;/h3-7,11,14,17,20H,1,8-10H2,2H3;1-5H;/q;;+2/t11-,14+,17-;;/m1../s1 |
| InChIKey | LYXIKEPXYWNLCH-ADKRVNNMSA-N |
| XLogP | 3.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|