About CID 45278397
CID 45278397 (PubChem CID 45278397) has the molecular formula C23H25FeNO4S+2
and a molecular weight of 467.37 g/mol.
Molecular Properties
| Compound Name | CID 45278397 |
| PubChem CID | 45278397 |
| Molecular Formula | C23H25FeNO4S+2 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)C1=C(CC[C]2[CH][CH][CH][CH]2)S[C@@H]2[C@@H]([C@@H](C)O)C(=O)N12.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C18H20NO4S.C5H5.Fe/c1-3-10-23-18(22)15-13(9-8-12-6-4-5-7-12)24-17-14(11(2)20)16(21)19(15)17;1-2-4-5-3-1;/h3-7,11,14,17,20H,1,8-10H2,2H3;1-5H;/q;;+2/t11-,14+,17-;;/m1../s1 |
| InChIKey | LYXIKEPXYWNLCH-ADKRVNNMSA-N |
| XLogP | 3.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 45278397 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 45278397?
The IUPAC name of CID 45278397 (CID 45278397) is not available.
What is the SMILES notation for CID 45278397?
The canonical SMILES for CID 45278397 is C=CCOC(=O)C1=C(CC[C]2[CH][CH][CH][CH]2)S[C@@H]2[C@@H]([C@@H](C)O)C(=O)N12.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 45278397?
The InChIKey is LYXIKEPXYWNLCH-ADKRVNNMSA-N. The full InChI is InChI=1S/C18H20NO4S.C5H5.Fe/c1-3-10-23-18(22)15-13(9-8-12-6-4-5-7-12)24-17-14(11(2)20)16(21)19(15)17;1-2-4-5-3-1;/h3-7,11,14,17,20H,1,8-10H2,2H3;1-5H;/q;;+2/t11-,14+,17-;;/m1../s1.
What are the key properties of CID 45278397?
CID 45278397 has a molecular weight of 467.37 g/mol, XLogP of 3.04, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 45278397 is sourced from PubChem (CID 45278397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).