C13H17NO8S — CID 88609052
acetyloxymethyl (5R)-6-(1-hydroxyethyl)-3-(methylperoxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 88609052) has the molecular formula C13H17NO8S and a molecular weight of 347.35 g/mol. Its IUPAC name is acetyloxymethyl (5R)-6-(1-hydroxyethyl)-3-(methylperoxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | acetyloxymethyl (5R)-6-(1-hydroxyethyl)-3-(methylperoxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88609052 |
| Molecular Formula | C13H17NO8S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | acetyloxymethyl (5R)-6-(1-hydroxyethyl)-3-(methylperoxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | COOCC1=C(C(=O)OCOC(C)=O)N2C(=O)C(C(C)O)[C@H]2S1 |
| InChI | InChI=1S/C13H17NO8S/c1-6(15)9-11(17)14-10(13(18)21-5-20-7(2)16)8(4-22-19-3)23-12(9)14/h6,9,12,15H,4-5H2,1-3H3/t6?,9?,12-/m1/s1 |
| InChIKey | RGCJZNNWUKQZEF-ALRJZHFGSA-N |
| XLogP | -0.25 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|